EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4S |
| Net Charge | 0 |
| Average Mass | 179.197 |
| Monoisotopic Mass | 179.02523 |
| SMILES | CSC(C(=O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO4S/c1-11-3(5(9)10)2(6)4(7)8/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/t2-,3?/m0/s1 |
| InChIKey | AOSGDBLMPHPJQU-SCQFTWEKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylthioaspartic acid (CHEBI:73621) has functional parent 3-thio-L-aspartic acid (CHEBI:74653) |
| 3-methylthioaspartic acid (CHEBI:73621) is a L-aspartic acid derivative (CHEBI:83978) |
| 3-methylthioaspartic acid (CHEBI:73621) is a amino dicarboxylic acid (CHEBI:36164) |
| 3-methylthioaspartic acid (CHEBI:73621) is a C4-dicarboxylic acid (CHEBI:66873) |
| 3-methylthioaspartic acid (CHEBI:73621) is a methyl sulfide (CHEBI:86315) |
| 3-methylthioaspartic acid (CHEBI:73621) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-methylthioaspartic acid (CHEBI:73621) is a sulfur-containing amino acid (CHEBI:26834) |
| 3-methylthioaspartic acid (CHEBI:73621) is conjugate acid of 3-methylthioaspartate(1−) (CHEBI:73620) |
| Incoming Relation(s) |
| 3-methylthioaspartate(1−) (CHEBI:73620) is conjugate base of 3-methylthioaspartic acid (CHEBI:73621) |
| 3-methylthioaspartic acid residue (CHEBI:73619) is substituent group from 3-methylthioaspartic acid (CHEBI:73621) |
| IUPAC Name |
|---|
| 3-(methylsulfanyl)-L-aspartic acid |
| Synonyms | Source |
|---|---|
| 3-(methylsulfanyl)aspartic acid | ChEBI |
| 3-(methylthio)-L-aspartic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18571117 | Reaxys |
| Citations |
|---|