EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO4S |
| Net Charge | 0 |
| Average Mass | 165.170 |
| Monoisotopic Mass | 165.00958 |
| SMILES | N[C@H](C(=O)O)C(S)C(=O)O |
| InChI | InChI=1S/C4H7NO4S/c5-1(3(6)7)2(10)4(8)9/h1-2,10H,5H2,(H,6,7)(H,8,9)/t1-,2?/m0/s1 |
| InChIKey | MWUQQPGZOPQTIX-PIKHSQJKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-thio-L-aspartic acid (CHEBI:74653) is a L-aspartic acid derivative (CHEBI:83978) |
| 3-thio-L-aspartic acid (CHEBI:74653) is a amino dicarboxylic acid (CHEBI:36164) |
| 3-thio-L-aspartic acid (CHEBI:74653) is a C4-dicarboxylic acid (CHEBI:66873) |
| 3-thio-L-aspartic acid (CHEBI:74653) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-thio-L-aspartic acid (CHEBI:74653) is a sulfur-containing amino acid (CHEBI:26834) |
| 3-thio-L-aspartic acid (CHEBI:74653) is a thiol (CHEBI:29256) |
| Incoming Relation(s) |
| 3-methylthioaspartic acid (CHEBI:73621) has functional parent 3-thio-L-aspartic acid (CHEBI:74653) |
| 3-thio-L-aspartic acid residue (CHEBI:74652) is substituent group from 3-thio-L-aspartic acid (CHEBI:74653) |
| IUPAC Name |
|---|
| 3-sulfanyl-L-aspartic acid |
| Synonym | Source |
|---|---|
| 3-mercapto-L-aspartic acid | ChEBI |