EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO4S |
| Net Charge | -1 |
| Average Mass | 178.189 |
| Monoisotopic Mass | 178.01795 |
| SMILES | CSC(C(=O)[O-])[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO4S/c1-11-3(5(9)10)2(6)4(7)8/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/p-1/t2-,3?/m0/s1 |
| InChIKey | AOSGDBLMPHPJQU-SCQFTWEKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylthioaspartate(1−) (CHEBI:73620) is a sulfur-containing amino-acid anion (CHEBI:63470) |
| 3-methylthioaspartate(1−) (CHEBI:73620) is a α-amino-acid anion (CHEBI:33558) |
| 3-methylthioaspartate(1−) (CHEBI:73620) is conjugate base of 3-methylthioaspartic acid (CHEBI:73621) |
| Incoming Relation(s) |
| 3-methylthioaspartic acid (CHEBI:73621) is conjugate acid of 3-methylthioaspartate(1−) (CHEBI:73620) |
| 3-methylthioaspartate residue (CHEBI:73599) is substituent group from 3-methylthioaspartate(1−) (CHEBI:73620) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-(methylsulfanyl)succinate |
| Synonyms | Source |
|---|---|
| 3-(methylsulfanyl)aspartate(1−) | ChEBI |
| (2R)-2-ammonio-3-(methylsulfanyl)succinate | IUPAC |
| 3-(methylsulfanyl)-L-aspartate | ChEBI |
| 3-(methylthio)-L-aspartate | ChEBI |