EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3S |
| Net Charge | 0 |
| Average Mass | 206.267 |
| Monoisotopic Mass | 206.07251 |
| SMILES | CSCC[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C7H14N2O3S/c1-13-3-2-5(8)7(12)9-4-6(10)11/h5H,2-4,8H2,1H3,(H,9,12)(H,10,11)/t5-/m0/s1 |
| InChIKey | QXOHLNCNYLGICT-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Gly (CHEBI:73611) has functional parent L-methionine (CHEBI:16643) |
| Met-Gly (CHEBI:73611) has functional parent glycine (CHEBI:15428) |
| Met-Gly (CHEBI:73611) has role metabolite (CHEBI:25212) |
| Met-Gly (CHEBI:73611) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionylglycine |
| Synonyms | Source |
|---|---|
| MG | ChEBI |
| M-G | ChEBI |
| L-Met-Gly | ChEBI |
| Methionylglycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028973 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726610 | Reaxys |
| CAS:14486-03-4 | ChemIDplus |