EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O5 |
| Net Charge | 0 |
| Average Mass | 204.182 |
| Monoisotopic Mass | 204.07462 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C7H12N2O5/c8-4(1-2-5(10)11)7(14)9-3-6(12)13/h4H,1-3,8H2,(H,9,14)(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | LSPKYLAFTPBWIL-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Gly (CHEBI:73505) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Gly (CHEBI:73505) has functional parent glycine (CHEBI:15428) |
| Glu-Gly (CHEBI:73505) has role metabolite (CHEBI:25212) |
| Glu-Gly (CHEBI:73505) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-glutamylglycine |
| Synonyms | Source |
|---|---|
| EG | ChEBI |
| E-G | ChEBI |
| L-Glu-Gly | ChEBI |
| α-L-Glu-Gly | ChEBI |
| glutamylglycine | ChEBI |
| α-glutamylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028819 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727354 | Reaxys |
| Citations |
|---|