EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N3O6S2 |
| Net Charge | 0 |
| Average Mass | 353.422 |
| Monoisotopic Mass | 353.07153 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C11H19N3O6S2/c12-5(1-2-8(15)16)9(17)13-6(3-21)10(18)14-7(4-22)11(19)20/h5-7,21-22H,1-4,12H2,(H,13,17)(H,14,18)(H,15,16)(H,19,20)/t5-,6-,7-/m0/s1 |
| InChIKey | MXPBQDFWIMBACQ-ACZMJKKPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Cys-Cys (CHEBI:73495) has functional parent L-cysteine (CHEBI:17561) |
| Glu-Cys-Cys (CHEBI:73495) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Cys-Cys (CHEBI:73495) has role metabolite (CHEBI:25212) |
| Glu-Cys-Cys (CHEBI:73495) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-cysteinyl-L-cysteine |
| Synonyms | Source |
|---|---|
| E-C-C | ChEBI |
| ECC | ChEBI |
| L-Glu-L-Cys-L-Cys | ChEBI |