EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N3O8 |
| Net Charge | 0 |
| Average Mass | 333.297 |
| Monoisotopic Mass | 333.11721 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H19N3O8/c13-6(1-3-8(16)17)11(22)15-7(2-4-9(18)19)12(23)14-5-10(20)21/h6-7H,1-5,13H2,(H,14,23)(H,15,22)(H,16,17)(H,18,19)(H,20,21)/t6-,7-/m0/s1 |
| InChIKey | SJPMNHCEWPTRBR-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Glu-Gly (CHEBI:73494) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Glu-Gly (CHEBI:73494) has functional parent glycine (CHEBI:15428) |
| Glu-Glu-Gly (CHEBI:73494) has role metabolite (CHEBI:25212) |
| Glu-Glu-Gly (CHEBI:73494) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-glutamylglycine |
| Synonyms | Source |
|---|---|
| E-E-G | ChEBI |
| EEG | ChEBI |
| L-Glu-L-Glu-L-Gly | ChEBI |