EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N4O5S |
| Net Charge | 0 |
| Average Mass | 472.567 |
| Monoisotopic Mass | 472.17804 |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H28N4O5S/c24-17(14-33)21(30)26-19(12-16-9-5-2-6-10-16)23(32)27-18(22(31)25-13-20(28)29)11-15-7-3-1-4-8-15/h1-10,17-19,33H,11-14,24H2,(H,25,31)(H,26,30)(H,27,32)(H,28,29)/t17-,18-,19-/m0/s1 |
| InChIKey | BQWNEMPMDFSLCY-FHWLQOOXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Phe-Phe-Gly (CHEBI:73460) has functional parent L-cysteine (CHEBI:17561) |
| Cys-Phe-Phe-Gly (CHEBI:73460) has functional parent L-phenylalanine (CHEBI:17295) |
| Cys-Phe-Phe-Gly (CHEBI:73460) has functional parent glycine (CHEBI:15428) |
| Cys-Phe-Phe-Gly (CHEBI:73460) has role metabolite (CHEBI:25212) |
| Cys-Phe-Phe-Gly (CHEBI:73460) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-cysteinyl-L-phenylalanyl-L-phenylalanylglycine |
| Synonyms | Source |
|---|---|
| C-F-F-G | ChEBI |
| L-Cys-L-Phe-L-Phe-Gly | ChEBI |
| CFFG | ChEBI |