EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N4O7S2 |
| Net Charge | 0 |
| Average Mass | 516.642 |
| Monoisotopic Mass | 516.17124 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CS)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C21H32N4O7S2/c1-11(26)17(25-19(29)15(7-8-34-2)23-18(28)14(22)10-33)20(30)24-16(21(31)32)9-12-3-5-13(27)6-4-12/h3-6,11,14-17,26-27,33H,7-10,22H2,1-2H3,(H,23,28)(H,24,30)(H,25,29)(H,31,32)/t11-,14+,15+,16+,17+/m1/s1 |
| InChIKey | PJJNGKSNTQJPBR-KFFAWSGCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Met-Thr-Tyr (CHEBI:73459) has functional parent L-cysteine (CHEBI:17561) |
| Cys-Met-Thr-Tyr (CHEBI:73459) has functional parent L-methionine (CHEBI:16643) |
| Cys-Met-Thr-Tyr (CHEBI:73459) has functional parent L-threonine (CHEBI:16857) |
| Cys-Met-Thr-Tyr (CHEBI:73459) has functional parent L-tyrosine (CHEBI:17895) |
| Cys-Met-Thr-Tyr (CHEBI:73459) has role metabolite (CHEBI:25212) |
| Cys-Met-Thr-Tyr (CHEBI:73459) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-cysteinyl-L-methionyl-L-threonyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| C-M-T-Y | ChEBI |
| CMTY | ChEBI |
| L-Cys-L-Met-L-Thr-L-Tyr | ChEBI |