EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N2O4 |
| Net Charge | +1 |
| Average Mass | 255.294 |
| Monoisotopic Mass | 255.13393 |
| SMILES | COc1ccc(OC)c(C(O)CNC(=O)C[NH3+])c1 |
| InChI | InChI=1S/C12H18N2O4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16)/p+1 |
| InChIKey | PTKSEFOSCHHMPD-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| midodrine(1+) (CHEBI:73243) is a ammonium ion derivative (CHEBI:35274) |
| midodrine(1+) (CHEBI:73243) is conjugate acid of midodrine (CHEBI:6933) |
| Incoming Relation(s) |
| midodrine hydrochloride (CHEBI:31847) has part midodrine(1+) (CHEBI:73243) |
| midodrine (CHEBI:6933) is conjugate base of midodrine(1+) (CHEBI:73243) |
| IUPAC Name |
|---|
| rac-2-{[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]amino}-2-oxoethanaminium |