EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4.HCl |
| Net Charge | 0 |
| Average Mass | 290.747 |
| Monoisotopic Mass | 290.10333 |
| SMILES | COc1ccc(OC)c(C(O)CNC(=O)CN)c1.Cl |
| InChI | InChI=1S/C12H18N2O4.ClH/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13;/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16);1H |
| InChIKey | MGCQZNBCJBRZDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| midodrine hydrochloride (CHEBI:31847) has part midodrine(1+) (CHEBI:73243) |
| midodrine hydrochloride (CHEBI:31847) has role sympathomimetic agent (CHEBI:35524) |
| midodrine hydrochloride (CHEBI:31847) has role vasoconstrictor agent (CHEBI:50514) |
| midodrine hydrochloride (CHEBI:31847) has role α-adrenergic agonist (CHEBI:35569) |
| midodrine hydrochloride (CHEBI:31847) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| rac-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]glycinamide hydrochloride |
| Synonyms | Source |
|---|---|
| (+-)-1-(2',5'-Dimethoxyphenyl)-2-glycinamidoethanol hydrochloride | ChemIDplus |
| (+-)-2-Amino-N-(beta-hydroxy-2,5-dimethoxyphenethyl)acetamide monohydrochloride | ChemIDplus |
| Midodrine HCl | ChemIDplus |
| (+-)-Midodrine hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Pro-Amatine | KEGG DRUG |
| ProAmatine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01307 | KEGG DRUG |
| DB00211 | DrugBank |
| HMDB0014356 | HMDB |
| WO2004018409 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6579688 | Reaxys |
| CAS:3092-17-9 | ChemIDplus |
| CAS:3092-17-9 | KEGG DRUG |
| Citations |
|---|