EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4 |
| Net Charge | 0 |
| Average Mass | 254.286 |
| Monoisotopic Mass | 254.12666 |
| SMILES | COc1ccc(OC)c(C(O)CNC(=O)CN)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16) |
| InChIKey | PTKSEFOSCHHMPD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| midodrine (CHEBI:6933) has functional parent deglymidodrine (CHEBI:73248) |
| midodrine (CHEBI:6933) has functional parent glycinamide (CHEBI:42843) |
| midodrine (CHEBI:6933) has role prodrug (CHEBI:50266) |
| midodrine (CHEBI:6933) has role sympathomimetic agent (CHEBI:35524) |
| midodrine (CHEBI:6933) has role vasoconstrictor agent (CHEBI:50514) |
| midodrine (CHEBI:6933) has role α-adrenergic agonist (CHEBI:35569) |
| midodrine (CHEBI:6933) is a amino acid amide (CHEBI:22475) |
| midodrine (CHEBI:6933) is a aromatic ether (CHEBI:35618) |
| midodrine (CHEBI:6933) is a secondary alcohol (CHEBI:35681) |
| midodrine (CHEBI:6933) is conjugate base of midodrine(1+) (CHEBI:73243) |
| Incoming Relation(s) |
| midodrine(1+) (CHEBI:73243) is conjugate acid of midodrine (CHEBI:6933) |
| IUPAC Name |
|---|
| rac-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]glycinamide |
| INNs | Source |
|---|---|
| midodrina | WHO MedNet |
| midodrine | ChemIDplus |
| midodrine | WHO MedNet |
| midodrinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(2',5'-Dimethoxyphenyl)-2-glycinamidoethanol | ChemIDplus |
| 2-Amino-N-(2,5-dimethoxy-beta-hydroxyphenethyl)acetamide | ChemIDplus |
| (±)-2-amino-N-(β-hydroxy-2,5-dimethoxyphenethyl)acetamide | ChEBI |
| DL-N1-(beta-Hydroxy-2,5-dimethoxyphenethyl)glycinamid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2384653 | Reaxys |
| CAS:42794-76-3 | KEGG COMPOUND |
| CAS:42794-76-3 | ChemIDplus |
| Citations |
|---|