EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73173 - 2,4-DB
| Formula | C10H10Cl2O3 |
| Net Charge | 0 |
| Average Mass | 249.093 |
| Monoisotopic Mass | 248.00070 |
| SMILES | O=C(O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) |
| InChIKey | YIVXMZJTEQBPQO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-DB (CHEBI:73173) has role agrochemical (CHEBI:33286) |
| 2,4-DB (CHEBI:73173) has role phenoxy herbicide (CHEBI:60575) |
| 2,4-DB (CHEBI:73173) has role synthetic auxin (CHEBI:26841) |
| 2,4-DB (CHEBI:73173) is a aromatic ether (CHEBI:35618) |
| 2,4-DB (CHEBI:73173) is a monocarboxylic acid (CHEBI:25384) |
| 2,4-DB (CHEBI:73173) is a organochlorine compound (CHEBI:36683) |
| 2,4-DB (CHEBI:73173) is conjugate acid of 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) |
| Incoming Relation(s) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) has functional parent 2,4-DB (CHEBI:73173) |
| 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) is conjugate base of 2,4-DB (CHEBI:73173) |
| IUPAC Name |
|---|
| 4-(2,4-dichlorophenoxy)butanoic acid |
| Synonyms | Source |
|---|---|
| 4-(2,4-Dichlorophenoxy)butyric acid | KEGG COMPOUND |
| 2,4-D butyric acid | ChemIDplus |
| γ-(2,4-dichlorophenoxy)-butyric acid | ChEBI |
| γ-(2,4-dichlorophenoxy)butanoic acid | ChEBI |
| γ-(2,4-dichlorophenoxy)butyric acid | NIST Chemistry WebBook |
| γ-(2,4-dichlorophenoxy)-butanoic acid | ChEBI |
| Brand Names | Source |
|---|---|
| Legumex | ChemIDplus |
| Embutox | ChEBI |
| Butoxone | ChemIDplus |
| Butyrac | ChemIDplus |