EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18Cl2N2O5 |
| Net Charge | 0 |
| Average Mass | 377.224 |
| Monoisotopic Mass | 376.05928 |
| SMILES | NC(=O)CC[C@H](NC(=O)CCCOc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H18Cl2N2O5/c16-9-3-5-12(10(17)8-9)24-7-1-2-14(21)19-11(15(22)23)4-6-13(18)20/h3,5,8,11H,1-2,4,6-7H2,(H2,18,20)(H,19,21)(H,22,23)/t11-/m0/s1 |
| InChIKey | KDJOGNVMKQDCJK-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) has functional parent 2,4-DB (CHEBI:73173) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) is a N2-acyl-L-glutamine (CHEBI:17008) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) is a aromatic ether (CHEBI:35618) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) is a dichlorobenzene (CHEBI:23697) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) is conjugate acid of N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine(1−) (CHEBI:143278) |
| Incoming Relation(s) |
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine(1−) (CHEBI:143278) is conjugate base of N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine (CHEBI:144862) |
| IUPAC Name |
|---|
| N2-[4-(2,4-dichlorophenoxy)butanoyl]-L-glutamine |
| Synonym | Source |
|---|---|
| (2S)-5-amino-2-[4-(2,4-dichlorophenoxy)butanoylamino]-5-oxopentanoic acid | ChEBI |
| Citations |
|---|