EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9Cl2O3 |
| Net Charge | -1 |
| Average Mass | 248.085 |
| Monoisotopic Mass | 246.99342 |
| SMILES | O=C([O-])CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14)/p-1 |
| InChIKey | YIVXMZJTEQBPQO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) has role agrochemical (CHEBI:33286) |
| 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) has role herbicide (CHEBI:24527) |
| 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) has role synthetic auxin (CHEBI:26841) |
| 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) is conjugate base of 2,4-DB (CHEBI:73173) |
| Incoming Relation(s) |
| 2,4-DB (CHEBI:73173) is conjugate acid of 4-(2,4-dichlorophenoxy)butanoate (CHEBI:143277) |
| IUPAC Name |
|---|
| 4-(2,4-dichlorophenoxy)butanoate |
| Synonyms | Source |
|---|---|
| 2,4-DB(1−) | ChEBI |
| 4-(2,4-dichlorophenoxy)butyrate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-(2,4-dichlorophenoxy)butanoate | UniProt |
| Citations |
|---|