EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N6O6S2 |
| Net Charge | -1 |
| Average Mass | 489.515 |
| Monoisotopic Mass | 489.06565 |
| SMILES | [H]C(=O)O[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(CSc3nnnn3C)CS[C@]12[H])c1ccccc1 |
| InChI | InChI=1S/C19H18N6O6S2/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30)/p-1/t12-,14-,17-/m1/s1 |
| InChIKey | RRJHESVQVSRQEX-SUYBPPKGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-formylcefamandole(1−) (CHEBI:73088) is a monocarboxylic acid anion (CHEBI:35757) |
| O-formylcefamandole(1−) (CHEBI:73088) is conjugate base of O-formylcefamandole (CHEBI:53654) |
| Incoming Relation(s) |
| cefamandole nafate (CHEBI:3481) has part O-formylcefamandole(1−) (CHEBI:73088) |
| O-formylcefamandole (CHEBI:53654) is conjugate acid of O-formylcefamandole(1−) (CHEBI:73088) |
| IUPAC Name |
|---|
| 7β-[(2R)-2-(formyloxy)-2-phenylacetamido]-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylate |