EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N6O6S2 |
| Net Charge | 0 |
| Average Mass | 490.523 |
| Monoisotopic Mass | 490.07292 |
| SMILES | [H]C(=O)O[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@]12[H])c1ccccc1 |
| InChI | InChI=1S/C19H18N6O6S2/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30)/t12-,14-,17-/m1/s1 |
| InChIKey | RRJHESVQVSRQEX-SUYBPPKGSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-formylcefamandole (CHEBI:53654) has functional parent cefamandole (CHEBI:3480) |
| O-formylcefamandole (CHEBI:53654) has role antibacterial agent (CHEBI:33282) |
| O-formylcefamandole (CHEBI:53654) has role prodrug (CHEBI:50266) |
| O-formylcefamandole (CHEBI:53654) is a cephalosporin (CHEBI:23066) |
| O-formylcefamandole (CHEBI:53654) is a formate ester (CHEBI:52343) |
| O-formylcefamandole (CHEBI:53654) is conjugate acid of O-formylcefamandole(1−) (CHEBI:73088) |
| Incoming Relation(s) |
| O-formylcefamandole(1−) (CHEBI:73088) is conjugate base of O-formylcefamandole (CHEBI:53654) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-(formyloxy)-2-phenylacetamido]-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylic acid |
| Synonym | Source |
|---|---|
| (6R,7R)-7-{[(2R)-2-(formyloxy)-2-phenylacetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 528 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406414 | Beilstein |
| CAS:57268-80-1 | ChemIDplus |