EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N6O6S2.Na |
| Net Charge | 0 |
| Average Mass | 512.505 |
| Monoisotopic Mass | 512.05487 |
| SMILES | [H]C(=O)O[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(CSc3nnnn3C)CS[C@]12[H])c1ccccc1.[Na+] |
| InChI | InChI=1S/C19H18N6O6S2.Na/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10;/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30);/q;+1/p-1/t12-,14-,17-;/m1./s1 |
| InChIKey | ICZOIXFFVKYXOM-YCLOEFEOSA-M |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefamandole nafate (CHEBI:3481) has part O-formylcefamandole(1−) (CHEBI:73088) |
| cefamandole nafate (CHEBI:3481) has role antibacterial drug (CHEBI:36047) |
| cefamandole nafate (CHEBI:3481) has role prodrug (CHEBI:50266) |
| cefamandole nafate (CHEBI:3481) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 7β-[(2R)-2-(formyloxy)-2-phenylacetamido]-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylate |
| Synonyms | Source |
|---|---|
| Cefamandol nafato | ChemIDplus |
| Cephamandole nafate | ChemIDplus |
| O-Formylcefamandole sodium | ChEBI |
| sodium (6R,7R)-7-{[(2R)-2-(formyloxy)-2-phenylacetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Sodium O-formylcefamandole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08102 | KEGG COMPOUND |
| D00909 | KEGG DRUG |
| DB01326 | DrugBank |
| CN101829118 | Patent |
| CN101822678 | Patent |
| CN101836960 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5403938 | Beilstein |
| CAS:42540-40-9 | KEGG COMPOUND |
| CAS:42540-40-9 | KEGG DRUG |
| CAS:42540-40-9 | ChemIDplus |
| Citations |
|---|