EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O4S |
| Net Charge | 0 |
| Average Mass | 370.430 |
| Monoisotopic Mass | 370.09873 |
| SMILES | CCC(=O)NS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-3-17(22)21-26(23,24)16-11-9-14(10-12-16)18-13(2)25-20-19(18)15-7-5-4-6-8-15/h4-12H,3H2,1-2H3,(H,21,22) |
| InChIKey | TZRHLKRLEZJVIJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parecoxib (CHEBI:73038) has functional parent valdecoxib (CHEBI:63634) |
| parecoxib (CHEBI:73038) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| parecoxib (CHEBI:73038) has role non-narcotic analgesic (CHEBI:35481) |
| parecoxib (CHEBI:73038) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| parecoxib (CHEBI:73038) has role prodrug (CHEBI:50266) |
| parecoxib (CHEBI:73038) is a N-sulfonylcarboxamide (CHEBI:90852) |
| parecoxib (CHEBI:73038) is a isoxazoles (CHEBI:55373) |
| IUPAC Name |
|---|
| N-{[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl}propanamide |
| INNs | Source |
|---|---|
| parecoxib | WHO MedNet |
| parecoxib | WHO MedNet |
| parécoxib | WHO MedNet |
| parecoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-((p-(5-methyl-3-phenyl-4-isoxazolyl)phenyl)sulfonyl)propionamide | ChemIDplus |
| SC 69124 | ChemIDplus |
| SC-69124 | ChemIDplus |