EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O3S |
| Net Charge | 0 |
| Average Mass | 314.366 |
| Monoisotopic Mass | 314.07251 |
| SMILES | Cc1onc(-c2ccccc2)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H14N2O3S/c1-11-15(12-7-9-14(10-8-12)22(17,19)20)16(18-21-11)13-5-3-2-4-6-13/h2-10H,1H3,(H2,17,19,20) |
| InChIKey | LNPDTQAFDNKSHK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antirheumatic drug A drug used to treat rheumatoid arthritis. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valdecoxib (CHEBI:63634) has role antipyretic (CHEBI:35493) |
| valdecoxib (CHEBI:63634) has role antirheumatic drug (CHEBI:35842) |
| valdecoxib (CHEBI:63634) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| valdecoxib (CHEBI:63634) has role non-narcotic analgesic (CHEBI:35481) |
| valdecoxib (CHEBI:63634) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| valdecoxib (CHEBI:63634) is a isoxazoles (CHEBI:55373) |
| valdecoxib (CHEBI:63634) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| parecoxib (CHEBI:73038) has functional parent valdecoxib (CHEBI:63634) |
| IUPAC Name |
|---|
| 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| valdecoxib | WHO MedNet |
| valdecoxib | WHO MedNet |
| valdécoxib | WHO MedNet |
| valdecoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(5-Methyl-3-phenyl-4-isoxazolyl)benzenesulfonamide | ChemIDplus |
| p-(5-Methyl-3-phenyl-4-isoxazolyl)benzenesulfonamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Bextra | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2799 | DrugCentral |
| COX | PDBeChem |
| D02709 | KEGG DRUG |
| DB00580 | DrugBank |
| HMDB0005033 | HMDB |
| LSM-5305 | LINCS |
| Valdecoxib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8563786 | Reaxys |
| CAS:181695-72-7 | ChemIDplus |
| CAS:181695-72-7 | KEGG DRUG |
| Citations |
|---|