EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H33BrN2O2 |
| Net Charge | +2 |
| Average Mass | 557.532 |
| Monoisotopic Mass | 556.17144 |
| SMILES | COc1[nH+]c2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CC[NH+](C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H31BrN2O2/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3/h4-17,20-21,30,36H,18-19H2,1-3H3/p+2/t30-,32-/m1/s1 |
| InChIKey | QUIJNHUBAXPXFS-XLJNKUFUSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bedaquiline(2+) (CHEBI:72706) is a ammonium ion derivative (CHEBI:35274) |
| bedaquiline(2+) (CHEBI:72706) is a organic cation (CHEBI:25697) |
| bedaquiline(2+) (CHEBI:72706) is conjugate acid of bedaquiline (CHEBI:72292) |
| Incoming Relation(s) |
| bedaquiline fumarate (CHEBI:72295) has part bedaquiline(2+) (CHEBI:72706) |
| bedaquiline (CHEBI:72292) is conjugate base of bedaquiline(2+) (CHEBI:72706) |
| IUPAC Name |
|---|
| 6-bromo-3-[(1R,2S)-4-(dimethylammonio)-2-hydroxy-2-(1-naphthyl)-1-phenylbutyl]-2-methoxyquinolinium |