EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31BrN2O2 |
| Net Charge | 0 |
| Average Mass | 555.516 |
| Monoisotopic Mass | 554.15689 |
| SMILES | COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H31BrN2O2/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3/h4-17,20-21,30,36H,18-19H2,1-3H3/t30-,32-/m1/s1 |
| InChIKey | QUIJNHUBAXPXFS-XLJNKUFUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. ATP synthase inhibitor A mitochondrial respiratory-chain inhibitor that interferes with the action of ATP synthase. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bedaquiline (CHEBI:72292) has role antitubercular agent (CHEBI:33231) |
| bedaquiline (CHEBI:72292) has role ATP synthase inhibitor (CHEBI:20854) |
| bedaquiline (CHEBI:72292) is a aromatic ether (CHEBI:35618) |
| bedaquiline (CHEBI:72292) is a naphthalenes (CHEBI:25477) |
| bedaquiline (CHEBI:72292) is a organobromine compound (CHEBI:37141) |
| bedaquiline (CHEBI:72292) is a quinolines (CHEBI:26513) |
| bedaquiline (CHEBI:72292) is a tertiary alcohol (CHEBI:26878) |
| bedaquiline (CHEBI:72292) is a tertiary amino compound (CHEBI:50996) |
| bedaquiline (CHEBI:72292) is conjugate base of bedaquiline(2+) (CHEBI:72706) |
| Incoming Relation(s) |
| bedaquiline(2+) (CHEBI:72706) is conjugate acid of bedaquiline (CHEBI:72292) |
| IUPAC Name |
|---|
| (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(1-naphthyl)-1-phenylbutan-2-ol |
| INNs | Source |
|---|---|
| bedaquilina | WHO MedNet |
| bedaquiline | KEGG DRUG |
| bédaquiline | WHO MedNet |
| bedaquilinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(6-Bromo-2-methoxy-quinolin-3-yl)-4-dimethylamino-2-naphthalen-1-yl-1-phenyl-butan-2-ol | KEGG COMPOUND |
| R 207910 | ChemIDplus |
| R207910 | ChemIDplus |
| TMC 207 | ChemIDplus |
| TMC-207 | ChemIDplus |
| TMC207 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4741 | DrugCentral |
| Bedaquiline | Wikipedia |
| BQ1 | PDBeChem |
| D09872 | KEGG DRUG |
| DB08903 | DrugBank |
| WO2005117875 | Patent |
| WO2006067048 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10733008 | Reaxys |
| CAS:654653-93-7 | KEGG COMPOUND |
| CAS:843663-66-1 | ChemIDplus |
| Citations |
|---|