EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31BrN2O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 671.588 |
| Monoisotopic Mass | 670.16785 |
| SMILES | COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1cccc2ccccc12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C32H31BrN2O2.C4H4O4/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3;5-3(6)1-2-4(7)8/h4-17,20-21,30,36H,18-19H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t30-,32-;/m1./s1 |
| InChIKey | ZLVSPMRFRHMMOY-WWCCMVHESA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. ATP synthase inhibitor A mitochondrial respiratory-chain inhibitor that interferes with the action of ATP synthase. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bedaquiline fumarate (CHEBI:72295) has part bedaquiline(2+) (CHEBI:72706) |
| bedaquiline fumarate (CHEBI:72295) has role antitubercular agent (CHEBI:33231) |
| bedaquiline fumarate (CHEBI:72295) has role ATP synthase inhibitor (CHEBI:20854) |
| bedaquiline fumarate (CHEBI:72295) is a fumarate salt (CHEBI:50921) |
| IUPAC Name |
|---|
| (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(1-naphthyl)-1-phenylbutan-2-ol bis[(2Z)-but-2-enedioate] |
| Synonyms | Source |
|---|---|
| R403323 | ChemIDplus |
| 6-bromo-3-[(1R,2S)-4-(dimethylammonio)-2-hydroxy-2-(1-naphthyl)-1-phenylbutyl]-2-methoxyquinolinium (2E)-but-2-enedioate | IUPAC |
| Brand Name | Source |
|---|---|
| Sirturo | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09873 | KEGG DRUG |
| WO2008068231 | Patent |
| DBSALT000016 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18368422 | Reaxys |
| CAS:845533-86-0 | ChemIDplus |