EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | C=C(C)[C@@H]1CC=C2CC[C@@H](O)[C@@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C15H24O/c1-10(2)12-5-6-13-7-8-14(16)11(3)15(13,4)9-12/h6,11-12,14,16H,1,5,7-9H2,2-4H3/t11-,12-,14-,15-/m1/s1 |
| InChIKey | TWGYXCCDWSORFO-QHSBEEBCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxycapsidiol (CHEBI:72638) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| 1-deoxycapsidiol (CHEBI:72638) has role plant metabolite (CHEBI:76924) |
| 1-deoxycapsidiol (CHEBI:72638) is a eremophilane sesquiterpenoid (CHEBI:36753) |
| IUPAC Name |
|---|
| (1S,2R,7R,8aR)-1,8a-dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-ol |
| Synonyms | Source |
|---|---|
| 3α-hydroxy-5-epiaristolochene | MetaCyc |
| epiaristolochen-3α-ol | ChEBI |
| (+)-1-deoxycapsidiol | ChEBI |
| 3α,4βH-eremophila-9,11-diene-3-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-4662 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3543289 | Reaxys |
| Citations |
|---|