EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H12O6.2Na |
| Net Charge | 0 |
| Average Mass | 418.312 |
| Monoisotopic Mass | 418.04293 |
| SMILES | CC(C1=C([O-])C(=O)c2ccccc2C1=O)C1=C([O-])C(=O)c2ccccc2C1=O.[Na+].[Na+] |
| InChI | InChI=1S/C22H14O6.2Na/c1-10(15-17(23)11-6-2-4-8-13(11)19(25)21(15)27)16-18(24)12-7-3-5-9-14(12)20(26)22(16)28;;/h2-10,27-28H,1H3;;/q;2*+1/p-2 |
| InChIKey | GTBSWVDKMJUHGW-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Impatiens balsamina (ncbitaxon:63779) | aerial part (BTO:0001658) | PubMed (12033510) |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| impatienolate (CHEBI:66069) has part impatienol(2−) (CHEBI:72635) |
| impatienolate (CHEBI:66069) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| impatienolate (CHEBI:66069) has role metabolite (CHEBI:25212) |
| impatienolate (CHEBI:66069) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 3,3'-ethane-1,1-diylbis(1,4-dioxo-1,4-dihydronaphthalen-2-olate) |
| Synonyms | Source |
|---|---|
| 2,2'-ethylidene bis(3-sodium hydroxide-1,4-nphthoquinone) | ChEBI |
| sodium 3-hydroxide-2([sodium 3-hydroxide-1,4-dioxo(2-naphthyl)]ethyl)naphthalene-1,4-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9603432 | Reaxys |
| Citations |
|---|