EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H12O6.2Na |
| Net Charge | 0 |
| Average Mass | 418.312 |
| Monoisotopic Mass | 418.04293 |
| SMILES | CC(C1=C([O-])C(=O)c2ccccc2C1=O)C1=C([O-])C(=O)c2ccccc2C1=O.[Na+].[Na+] |
| InChI | InChI=1S/C22H14O6.2Na/c1-10(15-17(23)11-6-2-4-8-13(11)19(25)21(15)27)16-18(24)12-7-3-5-9-14(12)20(26)22(16)28;;/h2-10,27-28H,1H3;;/q;2*+1/p-2 |
| InChIKey | GTBSWVDKMJUHGW-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Impatiens balsamina (ncbitaxon:63779) | aerial part (BTO:0001658) | PubMed (12033510) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| impatienolate (CHEBI:66069) has part impatienol(2−) (CHEBI:72635) |
| impatienolate (CHEBI:66069) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| impatienolate (CHEBI:66069) has role metabolite (CHEBI:25212) |
| impatienolate (CHEBI:66069) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 3,3'-ethane-1,1-diylbis(1,4-dioxo-1,4-dihydronaphthalen-2-olate) |
| Synonyms | Source |
|---|---|
| 2,2'-ethylidene bis(3-sodium hydroxide-1,4-nphthoquinone) | ChEBI |
| sodium 3-hydroxide-2([sodium 3-hydroxide-1,4-dioxo(2-naphthyl)]ethyl)naphthalene-1,4-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9603432 | Reaxys |
| Citations |
|---|