EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16N2O3 |
| Net Charge | +2 |
| Average Mass | 164.205 |
| Monoisotopic Mass | 164.11500 |
| SMILES | [NH3+][C@@H]1C[C@H]([NH3+])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,9-11H,1,7-8H2/p+2/t2-,3+,4+,5-,6- |
| InChIKey | DTFAJAKTSMLKAT-JDCCYXBGSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-deoxystreptamine(2+) (CHEBI:65069) is a ammonium ion derivative (CHEBI:35274) |
| 2-deoxystreptamine(2+) (CHEBI:65069) is a organic cation (CHEBI:25697) |
| 2-deoxystreptamine(2+) (CHEBI:65069) is conjugate acid of 2-deoxystreptamine(1+) (CHEBI:72447) |
| Incoming Relation(s) |
| 2-deoxystreptamine(1+) (CHEBI:72447) is conjugate base of 2-deoxystreptamine(2+) (CHEBI:65069) |
| IUPAC Name |
|---|
| (1R,3S,4R,5r,6S)-4,5,6-trihydroxycyclohexane-1,3-diaminium |
| Synonyms | Source |
|---|---|
| 2-deoxystreptaminium(2+) | ChEBI |
| 2-deoxystreptaminium dication | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-deoxystreptamine | UniProt |
| Citations |
|---|