EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24FN3O5.C4H6O5 |
| Net Charge | 0 |
| Average Mass | 635.601 |
| Monoisotopic Mass | 635.19152 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1OC.O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C28H24FN3O5.C4H6O5/c1-35-24-15-21-22(16-25(24)36-2)30-14-11-23(21)37-20-9-7-19(8-10-20)32-27(34)28(12-13-28)26(33)31-18-5-3-17(29)4-6-18;5-2(4(8)9)1-3(6)7/h3-11,14-16H,12-13H2,1-2H3,(H,31,33)(H,32,34);2,5H,1H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | HFCFMRYTXDINDK-WNQIDUERSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabozantinib malate (CHEBI:72319) has part cabozantinib (CHEBI:72317) |
| cabozantinib malate (CHEBI:72319) has role antineoplastic agent (CHEBI:35610) |
| cabozantinib malate (CHEBI:72319) has role prodrug (CHEBI:50266) |
| cabozantinib malate (CHEBI:72319) has role tyrosine kinase inhibitor (CHEBI:38637) |
| cabozantinib malate (CHEBI:72319) is a malate salt (CHEBI:50220) |
| IUPAC Name |
|---|
| N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (2S)-2-hydroxybutanedioate |
| Synonyms | Source |
|---|---|
| cabozantinib (S)-malate | ChEBI |
| Cabozantinib s-malate | KEGG DRUG |
| cabozantinib L-malate | ChEBI |
| BMS 907351 | ChemIDplus |
| XL-184 | ChemIDplus |
| BMS907351 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cometriq | KEGG DRUG |
| Cabometyx | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10095 | KEGG DRUG |
| WO2012109510 | Patent |
| WO2010083414 | Patent |
| Cabozantinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20538692 | Reaxys |
| CAS:1140909-48-3 | KEGG DRUG |
| CAS:1140909-48-3 | ChemIDplus |
| Citations |
|---|