EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24FN3O5 |
| Net Charge | 0 |
| Average Mass | 501.514 |
| Monoisotopic Mass | 501.17000 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1OC |
| InChI | InChI=1S/C28H24FN3O5/c1-35-24-15-21-22(16-25(24)36-2)30-14-11-23(21)37-20-9-7-19(8-10-20)32-27(34)28(12-13-28)26(33)31-18-5-3-17(29)4-6-18/h3-11,14-16H,12-13H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | ONIQOQHATWINJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabozantinib (CHEBI:72317) has role antineoplastic agent (CHEBI:35610) |
| cabozantinib (CHEBI:72317) has role tyrosine kinase inhibitor (CHEBI:38637) |
| cabozantinib (CHEBI:72317) is a aromatic ether (CHEBI:35618) |
| cabozantinib (CHEBI:72317) is a dicarboxylic acid diamide (CHEBI:35779) |
| cabozantinib (CHEBI:72317) is a organofluorine compound (CHEBI:37143) |
| cabozantinib (CHEBI:72317) is a quinolines (CHEBI:26513) |
| Incoming Relation(s) |
| cabozantinib malate (CHEBI:72319) has part cabozantinib (CHEBI:72317) |
| IUPAC Name |
|---|
| N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| Synonyms | Source |
|---|---|
| BMS 907351 | ChemIDplus |
| BMS-907351 | ChemIDplus |
| XL 184 | ChemIDplus |
| XL-184 | ChemIDplus |
| XL184 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4715 | DrugCentral |
| Cabozantinib | Wikipedia |
| D10062 | KEGG DRUG |
| LSM-1195 | LINCS |
| WO2012109510 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18631644 | Reaxys |
| CAS:849217-68-1 | ChemIDplus |
| CAS:849217-68-1 | KEGG DRUG |
| Citations |
|---|