EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O4 |
| Net Charge | 0 |
| Average Mass | 256.302 |
| Monoisotopic Mass | 256.14231 |
| SMILES | CC(C)Cc1c(O)[n+]([O-])c(CC(C)C)c(O)[n+]1[O-] |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)5-9-11(15)14(18)10(6-8(3)4)12(16)13(9)17/h7-8,15-16H,5-6H2,1-4H3 |
| InChIKey | WXWWNANFOZVVLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pulcherriminic acid (CHEBI:71599) has role metabolite (CHEBI:25212) |
| pulcherriminic acid (CHEBI:71599) is a hydroxypyrazine (CHEBI:71633) |
| pulcherriminic acid (CHEBI:71599) is a pyrazine N-oxide (CHEBI:71632) |
| pulcherriminic acid (CHEBI:71599) is conjugate acid of pulcherriminate(2−) (CHEBI:77663) |
| Incoming Relation(s) |
| pulcherrimin (CHEBI:71601) has functional parent pulcherriminic acid (CHEBI:71599) |
| pulcherriminate(2−) (CHEBI:77663) is conjugate base of pulcherriminic acid (CHEBI:71599) |
| IUPAC Name |
|---|
| 3,6-diisobutylpyrazine-2,5-diol 1,4-dioxide |
| Synonym | Source |
|---|---|
| 2,5-Diisobutyl-3,6-dihydroxy-pyrazine-1,4-dioxide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:889146 | Reaxys |
| CAS:957-86-8 | ChemIDplus |
| Citations |
|---|