EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18Fe2N2O4 |
| Net Charge | +2 |
| Average Mass | 365.976 |
| Monoisotopic Mass | 365.99543 |
| SMILES | CC(C)Cc1c2[n+](c(CC(C)C)c3[n+]1[O][Fe][O]3)[O][Fe][O]2 |
| InChI | InChI=1S/C12H20N2O4.2Fe/c1-7(2)5-9-11(15)14(18)10(6-8(3)4)12(16)13(9)17;;/h7-8,15-16H,5-6H2,1-4H3;;/q;2*+2/p-2 |
| InChIKey | XENTWZJLVFFYPY-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pulcherrimin (CHEBI:71601) has functional parent pulcherriminic acid (CHEBI:71599) |
| pulcherrimin (CHEBI:71601) has role biological pigment (CHEBI:26130) |
| pulcherrimin (CHEBI:71601) is a iron chelate (CHEBI:5975) |
| IUPAC Name |
|---|
| μ-[1,2-di(hydroxy-1κO)-4,5-di(hydroxy-2κO)-3,6-diisobutylpyrazinediiumato(4−)]diiron(2+) |
| Citations |
|---|