EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4 |
| Net Charge | -2 |
| Average Mass | 254.286 |
| Monoisotopic Mass | 254.12775 |
| SMILES | CC(C)Cc1c([O-])[n+]([O-])c(CC(C)C)c([O-])[n+]1[O-] |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)5-9-11(15)14(18)10(6-8(3)4)12(16)13(9)17/h7-8,15-16H,5-6H2,1-4H3/p-2 |
| InChIKey | WXWWNANFOZVVLD-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pulcherriminate(2−) (CHEBI:77663) has role metabolite (CHEBI:25212) |
| pulcherriminate(2−) (CHEBI:77663) is a organic anion (CHEBI:25696) |
| pulcherriminate(2−) (CHEBI:77663) is conjugate base of pulcherriminic acid (CHEBI:71599) |
| Incoming Relation(s) |
| pulcherriminic acid (CHEBI:71599) is conjugate acid of pulcherriminate(2−) (CHEBI:77663) |
| IUPAC Name |
|---|
| 3,6-diisobutylpyrazine-2,5-diolate 1,4-dioxide |
| Synonym | Source |
|---|---|
| pulcherriminic acid(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| pulcherriminic acid | UniProt |
| Citations |
|---|