EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C12H19N3O |
| Net Charge | +1 |
| Average Mass | 222.312 |
| Monoisotopic Mass | 222.16009 |
| SMILES | CNNCc1ccc(C(=O)NC(C)C)cc1.[H+] |
| InChI | InChI=1S/C12H19N3O/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3/h4-7,9,13-14H,8H2,1-3H3,(H,15,16)/p+1 |
| InChIKey | CPTBDICYNRMXFX-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procarbazine(1+) (CHEBI:71431) is a organic cation (CHEBI:25697) |
| procarbazine(1+) (CHEBI:71431) is conjugate acid of procarbazine (CHEBI:71417) |
| Incoming Relation(s) |
| procarbazine hydrochloride (CHEBI:71428) has part procarbazine(1+) (CHEBI:71431) |
| procarbazine (CHEBI:71417) is conjugate base of procarbazine(1+) (CHEBI:71431) |
| Synonym | Source |
|---|---|
| procarbazine cation | ChEBI |