EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | CC(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | BSYNRYMUTXBXSQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.1.1.188 (prostaglandin-F synthase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of prostaglandin-F synthase (EC 1.1.1.188). cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. drug allergen Any drug which causes the onset of an allergic reaction. prostaglandin antagonist A compound that inhibits the action of prostaglandins. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. plant activator Any compound that protects plants by activating their defence mechanisms. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anticoagulant An agent that prevents blood clotting. drug allergen Any drug which causes the onset of an allergic reaction. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. prostaglandin antagonist A compound that inhibits the action of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetylsalicylic acid (CHEBI:15365) has functional parent salicylic acid (CHEBI:16914) |
| acetylsalicylic acid (CHEBI:15365) has role anticoagulant (CHEBI:50249) |
| acetylsalicylic acid (CHEBI:15365) has role antipyretic (CHEBI:35493) |
| acetylsalicylic acid (CHEBI:15365) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| acetylsalicylic acid (CHEBI:15365) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| acetylsalicylic acid (CHEBI:15365) has role drug allergen (CHEBI:88188) |
| acetylsalicylic acid (CHEBI:15365) has role EC 1.1.1.188 (prostaglandin-F synthase) inhibitor (CHEBI:77425) |
| acetylsalicylic acid (CHEBI:15365) has role geroprotector (CHEBI:176497) |
| acetylsalicylic acid (CHEBI:15365) has role non-narcotic analgesic (CHEBI:35481) |
| acetylsalicylic acid (CHEBI:15365) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| acetylsalicylic acid (CHEBI:15365) has role plant activator (CHEBI:73182) |
| acetylsalicylic acid (CHEBI:15365) has role platelet aggregation inhibitor (CHEBI:50427) |
| acetylsalicylic acid (CHEBI:15365) has role prostaglandin antagonist (CHEBI:49023) |
| acetylsalicylic acid (CHEBI:15365) has role teratogenic agent (CHEBI:50905) |
| acetylsalicylic acid (CHEBI:15365) is a benzoic acids (CHEBI:22723) |
| acetylsalicylic acid (CHEBI:15365) is a phenyl acetates (CHEBI:140310) |
| acetylsalicylic acid (CHEBI:15365) is a salicylates (CHEBI:26596) |
| acetylsalicylic acid (CHEBI:15365) is conjugate acid of acetylsalicylate (CHEBI:13719) |
| Incoming Relation(s) |
| 2-acetyloxy-4-pentadecylbenzoic acid (CHEBI:149780) has functional parent acetylsalicylic acid (CHEBI:15365) |
| aspirin-based probe AP (CHEBI:141699) has functional parent acetylsalicylic acid (CHEBI:15365) |
| NCX-4040 (CHEBI:233566) has functional parent acetylsalicylic acid (CHEBI:15365) |
| Yosprala (CHEBI:134674) has part acetylsalicylic acid (CHEBI:15365) |
| acetylsalicylate (CHEBI:13719) is conjugate base of acetylsalicylic acid (CHEBI:15365) |
| IUPAC Name |
|---|
| 2-(acetyloxy)benzoic acid |
| INNs | Source |
|---|---|
| acide acétylsalicylique | ChemIDplus |
| ácido acetilsalicílico | NIST Chemistry WebBook |
| acidum acetylsalicylicum | NIST Chemistry WebBook |
| Synonyms | Source |
|---|---|
| 2-Acetoxybenzenecarboxylic acid | KEGG COMPOUND |
| 2-acetoxybenzoic acid | ChemIDplus |
| 2-(ACETYLOXY)BENZOIC ACID | PDBeChem |
| Acetylsalicylate | KEGG COMPOUND |
| Acetylsalicylic acid | KEGG COMPOUND |
| Acetylsalicylsäure | ChemIDplus |
| Brand Name | Source |
|---|---|
| Easprin | KEGG DRUG |
| Citations |
|---|