EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | CC(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | BSYNRYMUTXBXSQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.1.1.188 (prostaglandin-F synthase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of prostaglandin-F synthase (EC 1.1.1.188). prostaglandin antagonist A compound that inhibits the action of prostaglandins. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. anticoagulant An agent that prevents blood clotting. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. prostaglandin antagonist A compound that inhibits the action of prostaglandins. drug allergen Any drug which causes the onset of an allergic reaction. plant activator Any compound that protects plants by activating their defence mechanisms. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetylsalicylic acid (CHEBI:15365) has functional parent salicylic acid (CHEBI:16914) |
| acetylsalicylic acid (CHEBI:15365) has role anticoagulant (CHEBI:50249) |
| acetylsalicylic acid (CHEBI:15365) has role antipyretic (CHEBI:35493) |
| acetylsalicylic acid (CHEBI:15365) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| acetylsalicylic acid (CHEBI:15365) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| acetylsalicylic acid (CHEBI:15365) has role drug allergen (CHEBI:88188) |
| acetylsalicylic acid (CHEBI:15365) has role EC 1.1.1.188 (prostaglandin-F synthase) inhibitor (CHEBI:77425) |
| acetylsalicylic acid (CHEBI:15365) has role geroprotector (CHEBI:176497) |
| acetylsalicylic acid (CHEBI:15365) has role non-narcotic analgesic (CHEBI:35481) |
| acetylsalicylic acid (CHEBI:15365) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| acetylsalicylic acid (CHEBI:15365) has role plant activator (CHEBI:73182) |
| acetylsalicylic acid (CHEBI:15365) has role platelet aggregation inhibitor (CHEBI:50427) |
| acetylsalicylic acid (CHEBI:15365) has role prostaglandin antagonist (CHEBI:49023) |
| acetylsalicylic acid (CHEBI:15365) has role teratogenic agent (CHEBI:50905) |
| acetylsalicylic acid (CHEBI:15365) is a benzoic acids (CHEBI:22723) |
| acetylsalicylic acid (CHEBI:15365) is a phenyl acetates (CHEBI:140310) |
| acetylsalicylic acid (CHEBI:15365) is a salicylates (CHEBI:26596) |
| acetylsalicylic acid (CHEBI:15365) is conjugate acid of acetylsalicylate (CHEBI:13719) |
| Incoming Relation(s) |
| 2-acetyloxy-4-pentadecylbenzoic acid (CHEBI:149780) has functional parent acetylsalicylic acid (CHEBI:15365) |
| aspirin-based probe AP (CHEBI:141699) has functional parent acetylsalicylic acid (CHEBI:15365) |
| NCX-4040 (CHEBI:233566) has functional parent acetylsalicylic acid (CHEBI:15365) |
| Yosprala (CHEBI:134674) has part acetylsalicylic acid (CHEBI:15365) |
| acetylsalicylate (CHEBI:13719) is conjugate base of acetylsalicylic acid (CHEBI:15365) |
| IUPAC Name |
|---|
| 2-(acetyloxy)benzoic acid |
| INNs | Source |
|---|---|
| acide acétylsalicylique | ChemIDplus |
| ácido acetilsalicílico | NIST Chemistry WebBook |
| acidum acetylsalicylicum | NIST Chemistry WebBook |
| Synonyms | Source |
|---|---|
| 2-Acetoxybenzenecarboxylic acid | KEGG COMPOUND |
| 2-acetoxybenzoic acid | ChemIDplus |
| 2-(ACETYLOXY)BENZOIC ACID | PDBeChem |
| Acetylsalicylate | KEGG COMPOUND |
| Acetylsalicylic acid | KEGG COMPOUND |
| Acetylsalicylsäure | ChemIDplus |
| Brand Name | Source |
|---|---|
| Easprin | KEGG DRUG |
| Citations |
|---|