EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CCCCCC(=O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc(O)cc1C2 |
| InChI | InChI=1S/C20H20O6/c1-2-3-4-5-13(22)18-14(23)8-11-6-10-7-12(21)9-15(24)16(10)19(25)17(11)20(18)26/h7-9,21,23-24,26H,2-6H2,1H3 |
| InChIKey | CIFXLTLZYCPTJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norsolorinic acid anthrone (CHEBI:71354) has functional parent anthrone (CHEBI:33835) |
| norsolorinic acid anthrone (CHEBI:71354) has role fungal metabolite (CHEBI:76946) |
| norsolorinic acid anthrone (CHEBI:71354) is a anthracenes (CHEBI:46955) |
| norsolorinic acid anthrone (CHEBI:71354) is a cyclic ketone (CHEBI:3992) |
| norsolorinic acid anthrone (CHEBI:71354) is a polyketide (CHEBI:26188) |
| norsolorinic acid anthrone (CHEBI:71354) is conjugate acid of norsolorinate anthrone(2−) (CHEBI:71345) |
| norsolorinic acid anthrone (CHEBI:71354) is conjugate acid of norsolorinic acid anthrone(1−) (CHEBI:77904) |
| Incoming Relation(s) |
| norsolorinate anthrone(2−) (CHEBI:71345) is conjugate base of norsolorinic acid anthrone (CHEBI:71354) |
| norsolorinic acid anthrone(1−) (CHEBI:77904) is conjugate base of norsolorinic acid anthrone (CHEBI:71354) |
| IUPAC Name |
|---|
| 2-hexanoyl-1,3,6,8-tetrahydroxyanthracen-9(10H)-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-12588 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22552812 | Reaxys |
| Citations |
|---|