EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O |
| Net Charge | 0 |
| Average Mass | 194.233 |
| Monoisotopic Mass | 194.07316 |
| SMILES | O=C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H10O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8H,9H2 |
| InChIKey | RJGDLRCDCYRQOQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthrone (CHEBI:33835) has role radical scavenger (CHEBI:48578) |
| anthrone (CHEBI:33835) is a anthracenone (CHEBI:146281) |
| anthrone (CHEBI:33835) is tautomer of 9-anthrol (CHEBI:40753) |
| Incoming Relation(s) |
| 12-deoxynogalonic acid (CHEBI:81873) has functional parent anthrone (CHEBI:33835) |
| anthralin (CHEBI:37510) has functional parent anthrone (CHEBI:33835) |
| norsolorinic acid anthrone (CHEBI:71354) has functional parent anthrone (CHEBI:33835) |
| 9-anthrol (CHEBI:40753) is tautomer of anthrone (CHEBI:33835) |
| IUPAC Name |
|---|
| anthracen-9(10H)-one |
| Synonyms | Source |
|---|---|
| 9,10-dihydro-9-oxoanthracene | NIST Chemistry WebBook |
| 9(10H)-anthracenone | NIST Chemistry WebBook |
| 9-oxoanthracene | ChemIDplus |
| anthranone | ChemIDplus |
| anthrone | NIST Chemistry WebBook |
| Az-O | ChEBI |
| Citations |
|---|