EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | -2 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11144 |
| SMILES | CCCCCC(=O)c1c([O-])cc2c(c1O)C(=O)c1c(O)cc([O-])cc1C2 |
| InChI | InChI=1S/C20H20O6/c1-2-3-4-5-13(22)18-14(23)8-11-6-10-7-12(21)9-15(24)16(10)19(25)17(11)20(18)26/h7-9,21,23-24,26H,2-6H2,1H3/p-2 |
| InChIKey | CIFXLTLZYCPTJK-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norsolorinate anthrone(2−) (CHEBI:71345) is a organic anion (CHEBI:25696) |
| norsolorinate anthrone(2−) (CHEBI:71345) is conjugate base of norsolorinic acid anthrone (CHEBI:71354) |
| Incoming Relation(s) |
| norsolorinic acid anthrone (CHEBI:71354) is conjugate acid of norsolorinate anthrone(2−) (CHEBI:71345) |
| IUPAC Name |
|---|
| 3-hexanoyl-4,5-dihydroxy-10-oxo-9,10-dihydroanthracene-2,7-diolate |
| Synonyms | Source |
|---|---|
| norsolorinate anthrone | MetaCyc |
| norsolorinic acid anthrone(2−) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12588 | MetaCyc |
| Citations |
|---|