EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4O2S |
| Net Charge | 0 |
| Average Mass | 128.152 |
| Monoisotopic Mass | 127.99320 |
| SMILES | O=C(O)c1cccs1 |
| InChI | InChI=1S/C5H4O2S/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7) |
| InChIKey | QERYCTSHXKAMIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiophene-2-carboxylic acid (CHEBI:71241) is a thiophenecarboxylic acid (CHEBI:48436) |
| thiophene-2-carboxylic acid (CHEBI:71241) is conjugate acid of thiophene-2-carboxylate (CHEBI:71237) |
| Incoming Relation(s) |
| thiophene-2-carbonyl-CoA (CHEBI:15542) has functional parent thiophene-2-carboxylic acid (CHEBI:71241) |
| thiophene-2-carboxylate (CHEBI:71237) is conjugate base of thiophene-2-carboxylic acid (CHEBI:71241) |
| IUPAC Name |
|---|
| thiophene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-Carboxythiophene | NIST Chemistry WebBook |
| 2-Thenoic acid | NIST Chemistry WebBook |
| 2-thiophenecarboxylic acid | ChEBI |
| 2-Thiophenic acid | NIST Chemistry WebBook |
| Tenoic acid | KEGG DRUG |
| α-thiophenecarboxylic acid | NIST Chemistry WebBook |
| Citations |
|---|