EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38N7O17P3S2 |
| Net Charge | 0 |
| Average Mass | 877.678 |
| Monoisotopic Mass | 877.09784 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)c1cccs1 |
| InChI | InChI=1S/C26H38N7O17P3S2/c1-26(2,20(36)23(37)29-6-5-16(34)28-7-9-55-25(38)15-4-3-8-54-15)11-47-53(44,45)50-52(42,43)46-10-14-19(49-51(39,40)41)18(35)24(48-14)33-13-32-17-21(27)30-12-31-22(17)33/h3-4,8,12-14,18-20,24,35-36H,5-7,9-11H2,1-2H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/t14-,18-,19-,20+,24-/m1/s1 |
| InChIKey | APTYNAZODMUFPO-CITAKDKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiophene-2-carbonyl-CoA (CHEBI:15542) has functional parent coenzyme A (CHEBI:15346) |
| thiophene-2-carbonyl-CoA (CHEBI:15542) has functional parent thiophene-2-carboxylic acid (CHEBI:71241) |
| thiophene-2-carbonyl-CoA (CHEBI:15542) is a acyl-CoA (CHEBI:17984) |
| thiophene-2-carbonyl-CoA (CHEBI:15542) is conjugate acid of thiophene-2-carbonyl-CoA(4−) (CHEBI:57395) |
| Incoming Relation(s) |
| thiophene-2-carbonyl-CoA(4−) (CHEBI:57395) is conjugate base of thiophene-2-carbonyl-CoA (CHEBI:15542) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(thiophene-2-carbonyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| Thiophene-2-carbonyl-CoA | KEGG COMPOUND |
| thiophene-2-carbonyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07347 | KEGG COMPOUND |