EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H3O2S |
| Net Charge | -1 |
| Average Mass | 127.144 |
| Monoisotopic Mass | 126.98592 |
| SMILES | O=C([O-])c1cccs1 |
| InChI | InChI=1S/C5H4O2S/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)/p-1 |
| InChIKey | QERYCTSHXKAMIS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiophene-2-carboxylate (CHEBI:71237) is a monocarboxylic acid anion (CHEBI:35757) |
| thiophene-2-carboxylate (CHEBI:71237) is conjugate base of thiophene-2-carboxylic acid (CHEBI:71241) |
| Incoming Relation(s) |
| thiophene-2-carboxylic acid (CHEBI:71241) is conjugate acid of thiophene-2-carboxylate (CHEBI:71237) |
| IUPAC Name |
|---|
| thiophene-2-carboxylate |
| Synonyms | Source |
|---|---|
| thienyl-2-carboxylate | ChEBI |
| 2-carboxylatothiophene | ChEBI |
| 2-thiophenecarboxylate | ChEBI |
| 2-thienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| thiophene-2-carboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19597 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3663067 | Reaxys |
| Citations |
|---|