EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C21H25ClN2O3 |
| Net Charge | +1 |
| Average Mass | 389.903 |
| Monoisotopic Mass | 389.16265 |
| SMILES | O=C(O)CCCN1CCC(O[C@@H](c2ccc(Cl)cc2)c2ccccn2)CC1.[H+] |
| InChI | InChI=1S/C21H25ClN2O3/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26)/p+1/t21-/m0/s1 |
| InChIKey | YWGDOWXRIALTES-NRFANRHFSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bepotastine(1+) (CHEBI:71202) is a organic cation (CHEBI:25697) |
| bepotastine(1+) (CHEBI:71202) is conjugate acid of bepotastine (CHEBI:71204) |
| Incoming Relation(s) |
| bepotastine besylate (CHEBI:31281) has part bepotastine(1+) (CHEBI:71202) |
| bepotastine (CHEBI:71204) is conjugate base of bepotastine(1+) (CHEBI:71202) |
| Synonyms | Source |
|---|---|
| bepotastine cation | ChEBI |
| betotastine(1+) | ChEBI |
| betotastine cation | ChEBI |