EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3.C6H6O3S |
| Net Charge | 0 |
| Average Mass | 547.073 |
| Monoisotopic Mass | 546.15914 |
| SMILES | O=C(O)CCCN1CCC(O[C@@H](c2ccc(Cl)cc2)c2ccccn2)CC1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O3.C6H6O3S/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26;7-10(8,9)6-4-2-1-3-5-6/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26);1-5H,(H,7,8,9)/t21-;/m0./s1 |
| InChIKey | UDGHXQPQKQPSBB-BOXHHOBZSA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bepotastine besylate (CHEBI:31281) has part bepotastine(1+) (CHEBI:71202) |
| bepotastine besylate (CHEBI:31281) has role anti-allergic agent (CHEBI:50857) |
| bepotastine besylate (CHEBI:31281) has role H1-receptor antagonist (CHEBI:37955) |
| bepotastine besylate (CHEBI:31281) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| 4-{4-[(S)-(4-chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoic acid benzenesulfonate |
| Synonyms | Source |
|---|---|
| Bepotastine benzenesulfonate | ChemIDplus |
| Bepotastine besilate | KEGG DRUG |
| Bepotastine besylate | ChemIDplus |
| Betotastine besilate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Bepreve | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01654 | KEGG DRUG |
| DB04890 | DrugBank |
| EP1525884 | Patent |
| WO2012048059 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7903750 | Reaxys |
| CAS:190786-44-8 | KEGG DRUG |
| CAS:190786-44-8 | ChemIDplus |
| Citations |
|---|