EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3.C6H6O3S |
| Net Charge | 0 |
| Average Mass | 547.073 |
| Monoisotopic Mass | 546.15914 |
| SMILES | O=C(O)CCCN1CCC(O[C@@H](c2ccc(Cl)cc2)c2ccccn2)CC1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O3.C6H6O3S/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26;7-10(8,9)6-4-2-1-3-5-6/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26);1-5H,(H,7,8,9)/t21-;/m0./s1 |
| InChIKey | UDGHXQPQKQPSBB-BOXHHOBZSA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bepotastine besylate (CHEBI:31281) has part bepotastine(1+) (CHEBI:71202) |
| bepotastine besylate (CHEBI:31281) has role anti-allergic agent (CHEBI:50857) |
| bepotastine besylate (CHEBI:31281) has role H1-receptor antagonist (CHEBI:37955) |
| bepotastine besylate (CHEBI:31281) has role ophthalmology drug (CHEBI:66981) |
| bepotastine besylate (CHEBI:31281) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| 4-{4-[(S)-(4-chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoic acid benzenesulfonate |
| Synonyms | Source |
|---|---|
| Bepotastine benzenesulfonate | ChemIDplus |
| Bepotastine benzenesulfonate salt | ChEMBL |
| Bepotastine besilate | KEGG DRUG |
| Bepotastine besylate | ChemIDplus |
| Betotastine besilate | ChemIDplus |
| Talion | ChEMBL |
| Brand Name | Source |
|---|---|
| Bepreve | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01654 | KEGG DRUG |
| DB04890 | DrugBank |
| EP1525884 | Patent |
| WO2012048059 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7903750 | Reaxys |
| CAS:190786-44-8 | KEGG DRUG |
| CAS:190786-44-8 | ChemIDplus |
| Citations |
|---|