EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3 |
| Net Charge | 0 |
| Average Mass | 388.895 |
| Monoisotopic Mass | 388.15537 |
| SMILES | O=C(O)CCCN1CCC(O[C@@H](c2ccc(Cl)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26)/t21-/m0/s1 |
| InChIKey | YWGDOWXRIALTES-NRFANRHFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bepotastine (CHEBI:71204) has role anti-allergic agent (CHEBI:50857) |
| bepotastine (CHEBI:71204) has role H1-receptor antagonist (CHEBI:37955) |
| bepotastine (CHEBI:71204) is a ether (CHEBI:25698) |
| bepotastine (CHEBI:71204) is a monocarboxylic acid (CHEBI:25384) |
| bepotastine (CHEBI:71204) is a monochlorobenzenes (CHEBI:83403) |
| bepotastine (CHEBI:71204) is a piperidines (CHEBI:26151) |
| bepotastine (CHEBI:71204) is a pyridines (CHEBI:26421) |
| bepotastine (CHEBI:71204) is conjugate base of bepotastine(1+) (CHEBI:71202) |
| Incoming Relation(s) |
| bepotastine(1+) (CHEBI:71202) is conjugate acid of bepotastine (CHEBI:71204) |
| INNs | Source |
|---|---|
| bepotastine | KEGG DRUG |
| bepotastinum | WHO MedNet |
| bepotastina | WHO MedNet |
| bépotastine | WHO MedNet |
| Synonyms | Source |
|---|---|
| betotastine | ChEBI |
| 4-((4-Chlorophenyl)-2-pyridinylmethoxy)-1-piperidinebutanoic acid | ChemIDplus |
| (+)-4-(((S)-p-Chloro-alpha-2-pyridylbenzyl)oxy)-1-piperidinebutyric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09705 | KEGG DRUG |
| DB04890 | DrugBank |
| WO2008153289 | Patent |
| US2010168433 | Patent |
| WO2008123701 | Patent |
| EP1336602 | Patent |
| Bepotastine | Wikipedia |
| 341 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7910270 | Reaxys |
| CAS:125602-71-3 | KEGG DRUG |
| CAS:125602-71-3 | ChemIDplus |
| Citations |
|---|