EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26ClN7O2S.H2O |
| Net Charge | 0 |
| Average Mass | 506.032 |
| Monoisotopic Mass | 505.16629 |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCO)CC2)n1.O |
| InChI | InChI=1S/C22H26ClN7O2S.H2O/c1-14-4-3-5-16(23)20(14)28-21(32)17-13-24-22(33-17)27-18-12-19(26-15(2)25-18)30-8-6-29(7-9-30)10-11-31;/h3-5,12-13,31H,6-11H2,1-2H3,(H,28,32)(H,24,25,26,27);1H2 |
| InChIKey | XHXFZZNHDVTMLI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dasatinib monohydrate (CHEBI:70839) has part dasatinib (anhydrous) (CHEBI:49375) |
| dasatinib monohydrate (CHEBI:70839) has role antineoplastic agent (CHEBI:35610) |
| dasatinib monohydrate (CHEBI:70839) has role tyrosine kinase inhibitor (CHEBI:38637) |
| dasatinib monohydrate (CHEBI:70839) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| N-(2-chloro-6-methylphenyl)-2-({6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl}amino)-1,3-thiazole-5-carboxamide—water (1/1) |
| Synonyms | Source |
|---|---|
| dasatinib.H2O | ChEBI |
| N-(2-chloro-6-methylphenyl)-2-((6-(4-(2- hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxamide hydrate | ChemIDplus |
| dasatinib hydrate | ChemIDplus |
| BMS 35482503 | ChemIDplus |
| BMS 354825-03 | ChemIDplus |
| dasatinib | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sprycel | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2005077945 | Patent |
| D06414 | KEGG DRUG |
| WO2010139980 | Patent |
| WO2010139979 | Patent |
| WO2011095059 | Patent |
| WO2010067374 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14444783 | Reaxys |
| CAS:863127-77-9 | ChemIDplus |
| Citations |
|---|