EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26ClN7O2S |
| Net Charge | 0 |
| Average Mass | 488.017 |
| Monoisotopic Mass | 487.15572 |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCO)CC2)n1 |
| InChI | InChI=1S/C22H26ClN7O2S/c1-14-4-3-5-16(23)20(14)28-21(32)17-13-24-22(33-17)27-18-12-19(26-15(2)25-18)30-8-6-29(7-9-30)10-11-31/h3-5,12-13,31H,6-11H2,1-2H3,(H,28,32)(H,24,25,26,27) |
| InChIKey | ZBNZXTGUTAYRHI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dasatinib (anhydrous) (CHEBI:49375) has role anticoronaviral agent (CHEBI:149553) |
| dasatinib (anhydrous) (CHEBI:49375) has role antineoplastic agent (CHEBI:35610) |
| dasatinib (anhydrous) (CHEBI:49375) has role tyrosine kinase inhibitor (CHEBI:38637) |
| dasatinib (anhydrous) (CHEBI:49375) is a N-(2-hydroxyethyl)piperazine (CHEBI:46851) |
| dasatinib (anhydrous) (CHEBI:49375) is a N-arylpiperazine (CHEBI:46848) |
| dasatinib (anhydrous) (CHEBI:49375) is a 1,3-thiazoles (CHEBI:38418) |
| dasatinib (anhydrous) (CHEBI:49375) is a aminopyrimidine (CHEBI:38338) |
| dasatinib (anhydrous) (CHEBI:49375) is a monocarboxylic acid amide (CHEBI:29347) |
| dasatinib (anhydrous) (CHEBI:49375) is a organochlorine compound (CHEBI:36683) |
| dasatinib (anhydrous) (CHEBI:49375) is a secondary amino compound (CHEBI:50995) |
| dasatinib (anhydrous) (CHEBI:49375) is a tertiary amino compound (CHEBI:50996) |
| dasatinib (anhydrous) (CHEBI:49375) is conjugate base of dasatinib(1+) (CHEBI:190514) |
| Incoming Relation(s) |
| dasatinib monohydrate (CHEBI:70839) has part dasatinib (anhydrous) (CHEBI:49375) |
| dasatinib(1+) (CHEBI:190514) is conjugate acid of dasatinib (anhydrous) (CHEBI:49375) |
| IUPAC Name |
|---|
| N-(2-chloro-6-methylphenyl)-2-({6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl}amino)-1,3-thiazole-5-carboxamide |
| INNs | Source |
|---|---|
| dasatinib | WHO MedNet |
| dasatinib | WHO MedNet |
| dasatinib | WHO MedNet |
| dasatinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| anh. dasatinib | ChEBI |
| anhydrous dasatinib | ChEBI |
| BMS-354825 | ChEBI |
| BMS Dasatinib | ChEBI |
| dasatinib (anh.) | ChEBI |
| N-(2-CHLORO-6-METHYLPHENYL)-2-({6-[4-(2-HYDROXYETHYL)PIPERAZIN-1-YL]-2-METHYLPYRIMIDIN-4-YL}AMINO)-1,3-THIAZOLE-5-CARBOXAMIDE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 1N1 | PDBeChem |
| 785 | DrugCentral |
| D03658 | KEGG DRUG |
| Dasatinib | Wikipedia |
| DB01254 | DrugBank |
| HMDB0015384 | HMDB |
| LSM-1020 | LINCS |
| US7125875 | Patent |
| US7941725 | Patent |
| WO2010067374 | Patent |
| WO2010139979 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9966762 | Reaxys |
| CAS:302962-49-8 | ChemIDplus |
| Citations |
|---|