EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25N7O3 |
| Net Charge | 0 |
| Average Mass | 471.521 |
| Monoisotopic Mass | 471.20189 |
| SMILES | Cn1c(CNc2ccc(C(=N)N)cc2)nc2cc(C(=O)N(CCC(=O)O)c3ccccn3)ccc21 |
| InChI | InChI=1S/C25H25N7O3/c1-31-20-10-7-17(25(35)32(13-11-23(33)34)21-4-2-3-12-28-21)14-19(20)30-22(31)15-29-18-8-5-16(6-9-18)24(26)27/h2-10,12,14,29H,11,13,15H2,1H3,(H3,26,27)(H,33,34) |
| InChIKey | YBSJFWOBGCMAKL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor An EC 1.10.99.* (oxidoreductases acting on diphenols and related substances as donors, other acceptors) inhibitor that interferes with the action of ribosyldihydronicotinamide dehydrogenase (quinone), EC 1.10.99.2. EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dabigatran (CHEBI:70752) has role anticoagulant (CHEBI:50249) |
| dabigatran (CHEBI:70752) has role EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor (CHEBI:77020) |
| dabigatran (CHEBI:70752) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| dabigatran (CHEBI:70752) is a aromatic amide (CHEBI:62733) |
| dabigatran (CHEBI:70752) is a benzimidazoles (CHEBI:22715) |
| dabigatran (CHEBI:70752) is a carboxamidine (CHEBI:35359) |
| dabigatran (CHEBI:70752) is a pyridines (CHEBI:26421) |
| dabigatran (CHEBI:70752) is a β-alanine derivative (CHEBI:22823) |
| Incoming Relation(s) |
| N-(4-aminobutyl)dabigatranamide (CHEBI:73197) has functional parent dabigatran (CHEBI:70752) |
| dabigatran etexilate (CHEBI:70746) has functional parent dabigatran (CHEBI:70752) |
| INN | Source |
|---|---|
| dabigatran | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09707 | KEGG DRUG |
| Dabigatran | Wikipedia |
| US2006222640 | Patent |
| US2008015176 | Patent |
| US6087380 | Patent |
| WO2004014894 | Patent |
| WO2006004575 | Patent |
| WO2006103206 | Patent |
| WO2008009638 | Patent |
| WO2008009639 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9168207 | Reaxys |
| CAS:211914-51-1 | KEGG DRUG |
| Citations |
|---|