EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H41N7O5 |
| Net Charge | 0 |
| Average Mass | 627.746 |
| Monoisotopic Mass | 627.31692 |
| SMILES | CCCCCCOC(=O)/N=C(/N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C34H41N7O5/c1-4-6-7-10-21-46-34(44)39-32(35)24-12-15-26(16-13-24)37-23-30-38-27-22-25(14-17-28(27)40(30)3)33(43)41(20-18-31(42)45-5-2)29-11-8-9-19-36-29/h8-9,11-17,19,22,37H,4-7,10,18,20-21,23H2,1-3H3,(H2,35,39,44) |
| InChIKey | KSGXQBZTULBEEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). |
| Applications: | anticoagulant An agent that prevents blood clotting. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dabigatran etexilate (CHEBI:70746) has functional parent dabigatran (CHEBI:70752) |
| dabigatran etexilate (CHEBI:70746) has role anticoagulant (CHEBI:50249) |
| dabigatran etexilate (CHEBI:70746) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| dabigatran etexilate (CHEBI:70746) has role prodrug (CHEBI:50266) |
| dabigatran etexilate (CHEBI:70746) is a aromatic amide (CHEBI:62733) |
| dabigatran etexilate (CHEBI:70746) is a benzimidazoles (CHEBI:22715) |
| dabigatran etexilate (CHEBI:70746) is a carboxamidine (CHEBI:35359) |
| dabigatran etexilate (CHEBI:70746) is a carboxylic ester (CHEBI:33308) |
| dabigatran etexilate (CHEBI:70746) is a pyridines (CHEBI:26421) |
| dabigatran etexilate (CHEBI:70746) is a β-alanine derivative (CHEBI:22823) |
| dabigatran etexilate (CHEBI:70746) is conjugate base of dabigatran etexilate(1+) (CHEBI:70751) |
| Incoming Relation(s) |
| dabigatran etexilate(1+) (CHEBI:70751) is conjugate acid of dabigatran etexilate (CHEBI:70746) |
| IUPAC Name |
|---|
| ethyl N-[(2-{[(4-{N'-[(hexyloxy)carbonyl]carbamimidoyl}phenyl)amino]methyl}-1-methyl-1H-benzimidazol-5-yl)carbonyl]-N-pyridin-2-yl-β-alaninate |
| INN | Source |
|---|---|
| dabigatran etexilate | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 776 | DrugCentral |
| D07144 | KEGG DRUG |
| HMDB0015641 | HMDB |
| US2011275824 | Patent |
| WO2007047608 | Patent |
| WO2011061080 | Patent |
| WO2012027543 | Patent |
| WO2012077136 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15496119 | Reaxys |
| CAS:211915-06-9 | KEGG DRUG |
| CAS:211915-06-9 | ChemIDplus |
| Citations |
|---|