EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35N9O2 |
| Net Charge | 0 |
| Average Mass | 541.660 |
| Monoisotopic Mass | 541.29137 |
| SMILES | Cn1c(CNc2ccc(C(=N)N)cc2)nc2cc(C(=O)N(CCC(=O)NCCCCN)c3ccccn3)ccc21 |
| InChI | InChI=1S/C29H35N9O2/c1-37-24-12-9-21(18-23(24)36-26(37)19-35-22-10-7-20(8-11-22)28(31)32)29(40)38(25-6-2-4-15-33-25)17-13-27(39)34-16-5-3-14-30/h2,4,6-12,15,18,35H,3,5,13-14,16-17,19,30H2,1H3,(H3,31,32)(H,34,39) |
| InChIKey | YPNOCNAUIHBZMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. immunogen An antigen capable, on its own, of inducing an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-aminobutyl)dabigatranamide (CHEBI:73197) has functional parent dabigatran (CHEBI:70752) |
| N-(4-aminobutyl)dabigatranamide (CHEBI:73197) has functional parent putrescine (CHEBI:17148) |
| N-(4-aminobutyl)dabigatranamide (CHEBI:73197) has role hapten (CHEBI:59174) |
| N-(4-aminobutyl)dabigatranamide (CHEBI:73197) has role immunogen (CHEBI:60816) |
| N-(4-aminobutyl)dabigatranamide (CHEBI:73197) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-{3-[(4-aminobutyl)amino]-3-oxopropyl}-2-{[(4-carbamimidoylphenyl)amino]methyl}-1-methyl-N-(pyridin-2-yl)-1H-benzimidazole-5-carboxamide |
| Synonym | Source |
|---|---|
| dabigatran hapten | ChEBI |
| Citations |
|---|