EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C34H41N7O5 |
| Net Charge | +1 |
| Average Mass | 628.754 |
| Monoisotopic Mass | 628.32419 |
| SMILES | CCCCCCOC(=O)/N=C(/N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1.[H+] |
| InChI | InChI=1S/C34H41N7O5/c1-4-6-7-10-21-46-34(44)39-32(35)24-12-15-26(16-13-24)37-23-30-38-27-22-25(14-17-28(27)40(30)3)33(43)41(20-18-31(42)45-5-2)29-11-8-9-19-36-29/h8-9,11-17,19,22,37H,4-7,10,18,20-21,23H2,1-3H3,(H2,35,39,44)/p+1 |
| InChIKey | KSGXQBZTULBEEQ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dabigatran etexilate(1+) (CHEBI:70751) is a organic cation (CHEBI:25697) |
| dabigatran etexilate(1+) (CHEBI:70751) is conjugate acid of dabigatran etexilate (CHEBI:70746) |
| Incoming Relation(s) |
| dabigatran etexilate methanesulfonate (CHEBI:70743) has part dabigatran etexilate(1+) (CHEBI:70751) |
| dabigatran etexilate (CHEBI:70746) is conjugate base of dabigatran etexilate(1+) (CHEBI:70751) |
| Synonym | Source |
|---|---|
| dabigatran etexilate cation | ChEBI |