EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O |
| Net Charge | 0 |
| Average Mass | 440.756 |
| Monoisotopic Mass | 440.40182 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C31H52O/c1-20(2)21(3)10-11-22(4)23-14-18-31(9)25-12-13-26-28(5,6)27(32)16-17-29(26,7)24(25)15-19-30(23,31)8/h20,22-23,26-27,32H,3,10-19H2,1-2,4-9H3/t22-,23-,26+,27+,29-,30-,31+/m1/s1 |
| InChIKey | XJLZCPIILZRCPS-ANMPWZFDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eburicol (CHEBI:70315) has functional parent 24,25-dihydrolanosterol (CHEBI:28113) |
| eburicol (CHEBI:70315) has role fungal metabolite (CHEBI:76946) |
| eburicol (CHEBI:70315) is a 14α-methyl steroid (CHEBI:138029) |
| eburicol (CHEBI:70315) is a 3β-sterol (CHEBI:35348) |
| eburicol (CHEBI:70315) is a tetracyclic triterpenoid (CHEBI:26893) |
| Incoming Relation(s) |
| 32-hydroxyeburicol (CHEBI:194328) has functional parent eburicol (CHEBI:70315) |
| 32-ketoeburicol (CHEBI:194329) has functional parent eburicol (CHEBI:70315) |
| 4,4,24-trimethyl-5alpha-cholesta-8,14,24(28)-triene-3beta-ol (CHEBI:194330) has functional parent eburicol (CHEBI:70315) |
| 4,4,24-trimethylcholesta-8,24(28)-dien-3β-ol (CHEBI:176893) has functional parent eburicol (CHEBI:70315) |
| IUPAC Name |
|---|
| 24-methylidenelanost-8-en-3β-ol |
| Synonyms | Source |
|---|---|
| 24-methylene-24,25-dihydrolanosterol | KNApSAcK |
| 24-methylenedihydrolanosterol | ChEBI |
| 24-methylenelanost-8-en-3β-ol | ChemIDplus |
| 24-methylenelanostenol | ChEBI |
| 24-methylene lanosterol | ChEBI |
| (3β)-24-methylidenelanost-8-en-3-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| eburicol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00023805 | KNApSAcK |
| Eburicol | Wikipedia |
| LMST01031311 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2511887 | Reaxys |
| CAS:6890-88-6 | ChemIDplus |
| Citations |
|---|